C22H23F3N4 — CID 171658454
N-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-6-piperazin-1-ylquinolin-4-amine (PubChem CID 171658454) has the molecular formula C22H23F3N4 and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-6-piperazin-1-ylquinolin-4-amine.
| Compound Name | N-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-6-piperazin-1-ylquinolin-4-amine |
|---|---|
| PubChem CID | 171658454 |
| Molecular Formula | C22H23F3N4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-6-piperazin-1-ylquinolin-4-amine |
| SMILES | Cc1c(CNc2ccnc3ccc(N4CCNCC4)cc23)cccc1C(F)(F)F |
| InChI | InChI=1S/C22H23F3N4/c1-15-16(3-2-4-19(15)22(23,24)25)14-28-21-7-8-27-20-6-5-17(13-18(20)21)29-11-9-26-10-12-29/h2-8,13,26H,9-12,14H2,1H3,(H,27,28) |
| InChIKey | CISVKMUTFGTVJK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |