C16H17ClF3N5 — CID 123924474
4-chloro-N-(2-methyl-4-piperazin-1-ylphenyl)-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 123924474) has the molecular formula C16H17ClF3N5 and a molecular weight of 371.79 g/mol. Its IUPAC name is 4-chloro-N-(2-methyl-4-piperazin-1-ylphenyl)-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-N-(2-methyl-4-piperazin-1-ylphenyl)-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 123924474 |
| Molecular Formula | C16H17ClF3N5 |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-chloro-N-(2-methyl-4-piperazin-1-ylphenyl)-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCNCC2)ccc1Nc1ncc(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C16H17ClF3N5/c1-10-8-11(25-6-4-21-5-7-25)2-3-13(10)23-15-22-9-12(14(17)24-15)16(18,19)20/h2-3,8-9,21H,4-7H2,1H3,(H,22,23,24) |
| InChIKey | DPLKOFGIKFZRCF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|