C24H30F3N7OS — CID 170954031
N-[2-methyl-4-(4-piperazin-1-ylbutylsulfinyl)phenyl]-4-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 170954031) has the molecular formula C24H30F3N7OS and a molecular weight of 521.61 g/mol. Its IUPAC name is N-[2-methyl-4-(4-piperazin-1-ylbutylsulfinyl)phenyl]-4-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[2-methyl-4-(4-piperazin-1-ylbutylsulfinyl)phenyl]-4-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 170954031 |
| Molecular Formula | C24H30F3N7OS |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | N-[2-methyl-4-(4-piperazin-1-ylbutylsulfinyl)phenyl]-4-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1cc(S(=O)CCCCN2CCNCC2)ccc1Nc1ncc(C(F)(F)F)c(-c2cnn(C)c2)n1 |
| InChI | InChI=1S/C24H30F3N7OS/c1-17-13-19(36(35)12-4-3-9-34-10-7-28-8-11-34)5-6-21(17)31-23-29-15-20(24(25,26)27)22(32-23)18-14-30-33(2)16-18/h5-6,13-16,28H,3-4,7-12H2,1-2H3,(H,29,31,32) |
| InChIKey | YIBHINAIFPCEIM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|