C15H15N5O2 — CID 166476886
N-[4-[(diaminomethylideneamino)methyl]phenyl]-5-formylpyridine-2-carboxamide (PubChem CID 166476886) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-[4-[(diaminomethylideneamino)methyl]phenyl]-5-formylpyridine-2-carboxamide.
| Compound Name | N-[4-[(diaminomethylideneamino)methyl]phenyl]-5-formylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 166476886 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[4-[(diaminomethylideneamino)methyl]phenyl]-5-formylpyridine-2-carboxamide |
| SMILES | NC(N)=NCc1ccc(NC(=O)c2ccc(C=O)cn2)cc1 |
| InChI | InChI=1S/C15H15N5O2/c16-15(17)19-7-10-1-4-12(5-2-10)20-14(22)13-6-3-11(9-21)8-18-13/h1-6,8-9H,7H2,(H,20,22)(H4,16,17,19) |
| InChIKey | IIXDORSRCNFIGR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|