C18H28N2O4 — CID 166477048
tert-butyl N-[4-(4-amino-2-methylphenyl)-2-methylbutan-2-yl]oxycarbonylcarbamate (PubChem CID 166477048) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl N-[4-(4-amino-2-methylphenyl)-2-methylbutan-2-yl]oxycarbonylcarbamate.
| Compound Name | tert-butyl N-[4-(4-amino-2-methylphenyl)-2-methylbutan-2-yl]oxycarbonylcarbamate |
|---|---|
| PubChem CID | 166477048 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl N-[4-(4-amino-2-methylphenyl)-2-methylbutan-2-yl]oxycarbonylcarbamate |
| SMILES | Cc1cc(N)ccc1CCC(C)(C)OC(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O4/c1-12-11-14(19)8-7-13(12)9-10-18(5,6)24-16(22)20-15(21)23-17(2,3)4/h7-8,11H,9-10,19H2,1-6H3,(H,20,21,22) |
| InChIKey | IECDSHSSKFIMLF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|