C20H21BrClFN4O4 — CID 166478455
tert-butyl 4-(7-bromo-8-chloro-6-fluoro-2,4-dioxo-3,5-dihydroimidazo[4,5-c]quinolin-1-yl)piperidine-1-carboxylate (PubChem CID 166478455) has the molecular formula C20H21BrClFN4O4 and a molecular weight of 515.77 g/mol. Its IUPAC name is tert-butyl 4-(7-bromo-8-chloro-6-fluoro-2,4-dioxo-3,5-dihydroimidazo[4,5-c]quinolin-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(7-bromo-8-chloro-6-fluoro-2,4-dioxo-3,5-dihydroimidazo[4,5-c]quinolin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166478455 |
| Molecular Formula | C20H21BrClFN4O4 |
| Molecular Weight | 515.77 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | tert-butyl 4-(7-bromo-8-chloro-6-fluoro-2,4-dioxo-3,5-dihydroimidazo[4,5-c]quinolin-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2c(=O)[nH]c3c(=O)[nH]c4c(F)c(Br)c(Cl)cc4c32)CC1 |
| InChI | InChI=1S/C20H21BrClFN4O4/c1-20(2,3)31-19(30)26-6-4-9(5-7-26)27-16-10-8-11(22)12(21)13(23)14(10)24-17(28)15(16)25-18(27)29/h8-9H,4-7H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | FVTXKBFQROSBRQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.77 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|