C15H32N2 — CID 166478789
6-(2,2-dimethylpropyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-2,6-naphthyridine;ethane (PubChem CID 166478789) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-2,6-naphthyridine;ethane.
| Compound Name | 6-(2,2-dimethylpropyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-2,6-naphthyridine;ethane |
|---|---|
| PubChem CID | 166478789 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-2,6-naphthyridine;ethane |
| SMILES | CC.CC(C)(C)CN1CCC2CNCCC2C1 |
| InChI | InChI=1S/C13H26N2.C2H6/c1-13(2,3)10-15-7-5-11-8-14-6-4-12(11)9-15;1-2/h11-12,14H,4-10H2,1-3H3;1-2H3 |
| InChIKey | YFVBKBOPPZNBBY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |