C17H16NO2Si — CID 166479536
CID 166479536 (PubChem CID 166479536) has the molecular formula C17H16NO2Si and a molecular weight of 294.41 g/mol.
| Compound Name | CID 166479536 |
|---|---|
| PubChem CID | 166479536 |
| Molecular Formula | C17H16NO2Si |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | — |
| SMILES | C[Si](Cc1c[nH]c2c(-c3ccccc3)cccc12)C(=O)O |
| InChI | InChI=1S/C17H16NO2Si/c1-21(17(19)20)11-13-10-18-16-14(8-5-9-15(13)16)12-6-3-2-4-7-12/h2-10,18H,11H2,1H3,(H,19,20) |
| InChIKey | ZPBRCJKQLCTGRE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|