C25H23BClFN8O3 — CID 166482505
CID 166482505 (PubChem CID 166482505) has the molecular formula C25H23BClFN8O3 and a molecular weight of 548.78 g/mol.
| Compound Name | CID 166482505 |
|---|---|
| PubChem CID | 166482505 |
| Molecular Formula | C25H23BClFN8O3 |
| Molecular Weight | 548.78 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | — |
| SMILES | [B]n1c(C(=O)NCc2ccc(-n3cccn3)nc2)nc(NC(=O)c2cc(F)cc(Cl)c2)c1CNC(=O)C(C)C |
| InChI | InChI=1S/C25H23BClFN8O3/c1-14(2)23(37)31-13-19-21(34-24(38)16-8-17(27)10-18(28)9-16)33-22(36(19)26)25(39)30-12-15-4-5-20(29-11-15)35-7-3-6-32-35/h3-11,14H,12-13H2,1-2H3,(H,30,39)(H,31,37)(H,34,38) |
| InChIKey | FWMBXVMZTVXAGC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|