C11H17F3N2O — CID 166483323
3-hexan-3-yl-N-(2,2,2-trifluoroethyl)-1,2-oxazol-5-amine (PubChem CID 166483323) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is 3-hexan-3-yl-N-(2,2,2-trifluoroethyl)-1,2-oxazol-5-amine.
| Compound Name | 3-hexan-3-yl-N-(2,2,2-trifluoroethyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 166483323 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-hexan-3-yl-N-(2,2,2-trifluoroethyl)-1,2-oxazol-5-amine |
| SMILES | CCCC(CC)c1cc(NCC(F)(F)F)on1 |
| InChI | InChI=1S/C11H17F3N2O/c1-3-5-8(4-2)9-6-10(17-16-9)15-7-11(12,13)14/h6,8,15H,3-5,7H2,1-2H3 |
| InChIKey | AIHGDYNIWGQBNN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |