C29H37N5O5S — CID 166483862
(8R)-2-[[5-[(S)-amino(cyclopropyl)methyl]-8-[(2R,4R)-4-methylsulfonylpentan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one (PubChem CID 166483862) has the molecular formula C29H37N5O5S and a molecular weight of 567.71 g/mol. Its IUPAC name is (8R)-2-[[5-[(S)-amino(cyclopropyl)methyl]-8-[(2R,4R)-4-methylsulfonylpentan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one.
| Compound Name | (8R)-2-[[5-[(S)-amino(cyclopropyl)methyl]-8-[(2R,4R)-4-methylsulfonylpentan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 166483862 |
| Molecular Formula | C29H37N5O5S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | (8R)-2-[[5-[(S)-amino(cyclopropyl)methyl]-8-[(2R,4R)-4-methylsulfonylpentan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| SMILES | C[C@H](C[C@@H](C)S(C)(=O)=O)Oc1ncc([C@@H](N)C2CC2)c2cc(Nc3ccc4c(n3)[C@@H](C)C(C)(C)OC4=O)ncc12 |
| InChI | InChI=1S/C29H37N5O5S/c1-15(11-16(2)40(6,36)37)38-27-22-14-31-24(12-20(22)21(13-32-27)25(30)18-7-8-18)33-23-10-9-19-26(34-23)17(3)29(4,5)39-28(19)35/h9-10,12-18,25H,7-8,11,30H2,1-6H3,(H,31,33,34)/t15-,16-,17-,25+/m1/s1 |
| InChIKey | JTKCJSOOXMGQQZ-RKEPPDDRSA-N |
| XLogP | 4.82 |
| TPSA | 146.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |