C26H28F2N4O4 — CID 166484179
(8R)-2-[[5-(1-cyclopropyl-1-hydroxyethyl)-8-(2,2-difluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one (PubChem CID 166484179) has the molecular formula C26H28F2N4O4 and a molecular weight of 498.53 g/mol. Its IUPAC name is (8R)-2-[[5-(1-cyclopropyl-1-hydroxyethyl)-8-(2,2-difluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one.
| Compound Name | (8R)-2-[[5-(1-cyclopropyl-1-hydroxyethyl)-8-(2,2-difluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 166484179 |
| Molecular Formula | C26H28F2N4O4 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (8R)-2-[[5-(1-cyclopropyl-1-hydroxyethyl)-8-(2,2-difluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| SMILES | C[C@@H]1c2nc(Nc3cc4c(C(C)(O)C5CC5)cnc(OCC(F)F)c4cn3)ccc2C(=O)OC1(C)C |
| InChI | InChI=1S/C26H28F2N4O4/c1-13-22-15(24(33)36-25(13,2)3)7-8-20(32-22)31-21-9-16-17(10-29-21)23(35-12-19(27)28)30-11-18(16)26(4,34)14-5-6-14/h7-11,13-14,19,34H,5-6,12H2,1-4H3,(H,29,31,32)/t13-,26?/m1/s1 |
| InChIKey | VTJRDGRQXKNMTN-OLADXZERSA-N |
| XLogP | 5.08 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |