C26H27F3N4O4 — CID 166484173
(8R)-2-[[5-[(1R)-1-cyclopropyl-1-hydroxyethyl]-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one (PubChem CID 166484173) has the molecular formula C26H27F3N4O4 and a molecular weight of 516.52 g/mol. Its IUPAC name is (8R)-2-[[5-[(1R)-1-cyclopropyl-1-hydroxyethyl]-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one.
| Compound Name | (8R)-2-[[5-[(1R)-1-cyclopropyl-1-hydroxyethyl]-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 166484173 |
| Molecular Formula | C26H27F3N4O4 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | (8R)-2-[[5-[(1R)-1-cyclopropyl-1-hydroxyethyl]-8-(2,2,2-trifluoroethoxy)-2,7-naphthyridin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| SMILES | C[C@@H]1c2nc(Nc3cc4c([C@](C)(O)C5CC5)cnc(OCC(F)(F)F)c4cn3)ccc2C(=O)OC1(C)C |
| InChI | InChI=1S/C26H27F3N4O4/c1-13-21-15(23(34)37-24(13,2)3)7-8-19(33-21)32-20-9-16-17(10-30-20)22(36-12-26(27,28)29)31-11-18(16)25(4,35)14-5-6-14/h7-11,13-14,35H,5-6,12H2,1-4H3,(H,30,32,33)/t13-,25-/m1/s1 |
| InChIKey | DHKIGVBEKPUDHN-YMXBGEKHSA-N |
| XLogP | 5.38 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |