C26H31N3O3S — CID 16648477
(5E)-5-[(2-butoxyphenyl)methylidene]-3-[[4-(3-methylphenyl)piperazin-1-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 16648477) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is (5E)-5-[(2-butoxyphenyl)methylidene]-3-[[4-(3-methylphenyl)piperazin-1-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-butoxyphenyl)methylidene]-3-[[4-(3-methylphenyl)piperazin-1-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 16648477 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (5E)-5-[(2-butoxyphenyl)methylidene]-3-[[4-(3-methylphenyl)piperazin-1-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCOc1ccccc1/C=C1/SC(=O)N(CN2CCN(c3cccc(C)c3)CC2)C1=O |
| InChI | InChI=1S/C26H31N3O3S/c1-3-4-16-32-23-11-6-5-9-21(23)18-24-25(30)29(26(31)33-24)19-27-12-14-28(15-13-27)22-10-7-8-20(2)17-22/h5-11,17-18H,3-4,12-16,19H2,1-2H3/b24-18+ |
| InChIKey | LJLSVOANZRQXHB-HKOYGPOVSA-N |
| XLogP | 4.99 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|