C20H26ClN3O — CID 166485394
1-[4-(2-chloro-6-methylquinolin-3-yl)piperazin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 166485394) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is 1-[4-(2-chloro-6-methylquinolin-3-yl)piperazin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(2-chloro-6-methylquinolin-3-yl)piperazin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 166485394 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[4-(2-chloro-6-methylquinolin-3-yl)piperazin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | Cc1ccc2nc(Cl)c(N3CCN(C(=O)CC(C)(C)C)CC3)cc2c1 |
| InChI | InChI=1S/C20H26ClN3O/c1-14-5-6-16-15(11-14)12-17(19(21)22-16)23-7-9-24(10-8-23)18(25)13-20(2,3)4/h5-6,11-12H,7-10,13H2,1-4H3 |
| InChIKey | NMMHECCTGPINIW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|