C19H14F3N3O3 — CID 166487400
2-oxo-5-[4-(pyridin-3-ylmethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 166487400) has the molecular formula C19H14F3N3O3 and a molecular weight of 389.33 g/mol. Its IUPAC name is 2-oxo-5-[4-(pyridin-3-ylmethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-5-[4-(pyridin-3-ylmethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166487400 |
| Molecular Formula | C19H14F3N3O3 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-oxo-5-[4-(pyridin-3-ylmethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(OCc3cccnc3)cc2)c(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C19H14F3N3O3/c20-19(21,22)16-14(8-15(17(23)26)18(27)25-16)12-3-5-13(6-4-12)28-10-11-2-1-7-24-9-11/h1-9H,10H2,(H2,23,26)(H,25,27) |
| InChIKey | YWPLSPWIBMDADN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |