C18H13F3N2O3S — CID 166486981
2-oxo-5-[4-(thiophen-3-ylmethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 166486981) has the molecular formula C18H13F3N2O3S and a molecular weight of 394.37 g/mol. Its IUPAC name is 2-oxo-5-[4-(thiophen-3-ylmethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-5-[4-(thiophen-3-ylmethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166486981 |
| Molecular Formula | C18H13F3N2O3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-oxo-5-[4-(thiophen-3-ylmethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(OCc3ccsc3)cc2)c(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C18H13F3N2O3S/c19-18(20,21)15-13(7-14(16(22)24)17(25)23-15)11-1-3-12(4-2-11)26-8-10-5-6-27-9-10/h1-7,9H,8H2,(H2,22,24)(H,23,25) |
| InChIKey | ATTSOMAIQWHERF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |