C25H28F3N5O3 — CID 166487375
5-[4-[[2-(heptylamino)pyrimidin-5-yl]methoxy]phenyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 166487375) has the molecular formula C25H28F3N5O3 and a molecular weight of 503.53 g/mol. Its IUPAC name is 5-[4-[[2-(heptylamino)pyrimidin-5-yl]methoxy]phenyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 5-[4-[[2-(heptylamino)pyrimidin-5-yl]methoxy]phenyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166487375 |
| Molecular Formula | C25H28F3N5O3 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 5-[4-[[2-(heptylamino)pyrimidin-5-yl]methoxy]phenyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | CCCCCCCNc1ncc(COc2ccc(-c3cc(C(N)=O)c(=O)[nH]c3C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C25H28F3N5O3/c1-2-3-4-5-6-11-30-24-31-13-16(14-32-24)15-36-18-9-7-17(8-10-18)19-12-20(22(29)34)23(35)33-21(19)25(26,27)28/h7-10,12-14H,2-6,11,15H2,1H3,(H2,29,34)(H,33,35)(H,30,31,32) |
| InChIKey | NARKIBIJZMOGSL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|