C12H15F3FmNO3- — CID 166490283
fermium;formic acid;[1-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]propan-2-ylamino]methanone (PubChem CID 166490283) has the molecular formula C12H15F3FmNO3- and a molecular weight of 535.25 g/mol. Its IUPAC name is fermium;formic acid;[1-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]propan-2-ylamino]methanone.
| Compound Name | fermium;formic acid;[1-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]propan-2-ylamino]methanone |
|---|---|
| PubChem CID | 166490283 |
| Molecular Formula | C12H15F3FmNO3- |
| Molecular Weight | 535.25 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | fermium;formic acid;[1-[6-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]propan-2-ylamino]methanone |
| SMILES | CC(CC1=CCCC=C1C(F)(F)F)N[C-]=O.O=CO.[Fm] |
| InChI | InChI=1S/C11H13F3NO.CH2O2.Fm/c1-8(15-7-16)6-9-4-2-3-5-10(9)11(12,13)14;2-1-3;/h4-5,8H,2-3,6H2,1H3,(H,15,16);1H,(H,2,3);/q-1;; |
| InChIKey | JNMMNNYWYOOPDA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|