C17H15F3FmNO4- — CID 166490365
fermium;1-methyl-4-[3-(trifluoromethoxy)phenyl]benzene;2-(oxomethylamino)acetic acid (PubChem CID 166490365) has the molecular formula C17H15F3FmNO4- and a molecular weight of 611.30 g/mol. Its IUPAC name is fermium;1-methyl-4-[3-(trifluoromethoxy)phenyl]benzene;2-(oxomethylamino)acetic acid.
| Compound Name | fermium;1-methyl-4-[3-(trifluoromethoxy)phenyl]benzene;2-(oxomethylamino)acetic acid |
|---|---|
| PubChem CID | 166490365 |
| Molecular Formula | C17H15F3FmNO4- |
| Molecular Weight | 611.30 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | fermium;1-methyl-4-[3-(trifluoromethoxy)phenyl]benzene;2-(oxomethylamino)acetic acid |
| SMILES | Cc1ccc(-c2cccc(OC(F)(F)F)c2)cc1.O=[C-]NCC(=O)O.[Fm] |
| InChI | InChI=1S/C14H11F3O.C3H4NO3.Fm/c1-10-5-7-11(8-6-10)12-3-2-4-13(9-12)18-14(15,16)17;5-2-4-1-3(6)7;/h2-9H,1H3;1H2,(H,4,5)(H,6,7);/q;-1; |
| InChIKey | XSVMLXKXZCJYJH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|