C20H20F2N4O — CID 166490581
(Z)-3-[3,5-difluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-4-imino-4-pyridin-4-ylbut-2-en-2-amine (PubChem CID 166490581) has the molecular formula C20H20F2N4O and a molecular weight of 370.40 g/mol. Its IUPAC name is (Z)-3-[3,5-difluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-4-imino-4-pyridin-4-ylbut-2-en-2-amine.
| Compound Name | (Z)-3-[3,5-difluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-4-imino-4-pyridin-4-ylbut-2-en-2-amine |
|---|---|
| PubChem CID | 166490581 |
| Molecular Formula | C20H20F2N4O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (Z)-3-[3,5-difluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-4-imino-4-pyridin-4-ylbut-2-en-2-amine |
| SMILES | [H]/N=C(C(=C(/C)N)/c1cc(F)c(N2CC3(COC3)C2)c(F)c1)\c1ccncc1 |
| InChI | InChI=1S/C20H20F2N4O/c1-12(23)17(18(24)13-2-4-25-5-3-13)14-6-15(21)19(16(22)7-14)26-8-20(9-26)10-27-11-20/h2-7,24H,8-11,23H2,1H3/b17-12-,24-18+ |
| InChIKey | NJOIIXLFYMANFA-VWSKUHLBSA-N |
| XLogP | 2.95 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|