C20H14F6N4S — CID 166491342
(4S)-4-[2-[1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrazol-4-yl]phenyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carbonitrile (PubChem CID 166491342) has the molecular formula C20H14F6N4S and a molecular weight of 456.42 g/mol. Its IUPAC name is (4S)-4-[2-[1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrazol-4-yl]phenyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carbonitrile.
| Compound Name | (4S)-4-[2-[1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrazol-4-yl]phenyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 166491342 |
| Molecular Formula | C20H14F6N4S |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | (4S)-4-[2-[1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrazol-4-yl]phenyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc2c(s1)CNC[C@H]2c1ccccc1-c1cn(CC(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C20H14F6N4S/c21-19(22,23)10-30-9-16(18(29-30)20(24,25)26)13-4-2-1-3-12(13)15-7-28-8-17-14(15)5-11(6-27)31-17/h1-5,9,15,28H,7-8,10H2/t15-/m0/s1 |
| InChIKey | YERGASUATMKOIV-HNNXBMFYSA-N |
| XLogP | 5.30 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |