C23H18N4O3 — CID 166492273
4-[[2-(3-hydroxy-3-methyl-2-oxoindol-1-yl)-4-pyridinyl]methyl]-2H-phthalazin-1-one (PubChem CID 166492273) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[[2-(3-hydroxy-3-methyl-2-oxoindol-1-yl)-4-pyridinyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[2-(3-hydroxy-3-methyl-2-oxoindol-1-yl)-4-pyridinyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 166492273 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-[[2-(3-hydroxy-3-methyl-2-oxoindol-1-yl)-4-pyridinyl]methyl]-2H-phthalazin-1-one |
| SMILES | CC1(O)C(=O)N(c2cc(Cc3n[nH]c(=O)c4ccccc34)ccn2)c2ccccc21 |
| InChI | InChI=1S/C23H18N4O3/c1-23(30)17-8-4-5-9-19(17)27(22(23)29)20-13-14(10-11-24-20)12-18-15-6-2-3-7-16(15)21(28)26-25-18/h2-11,13,30H,12H2,1H3,(H,26,28) |
| InChIKey | LNJKLGOXKMEXLD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |