C18H18N4O2 — CID 16649276
1-(4-methoxyphenyl)-N,5-dimethyl-N-phenyltriazole-4-carboxamide (PubChem CID 16649276) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N,5-dimethyl-N-phenyltriazole-4-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N,5-dimethyl-N-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 16649276 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-(4-methoxyphenyl)-N,5-dimethyl-N-phenyltriazole-4-carboxamide |
| SMILES | COc1ccc(-n2nnc(C(=O)N(C)c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C18H18N4O2/c1-13-17(18(23)21(2)14-7-5-4-6-8-14)19-20-22(13)15-9-11-16(24-3)12-10-15/h4-12H,1-3H3 |
| InChIKey | AGDMDTNOKYWSDZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |