C22H22N6O2 — CID 112822182
N-(2-benzyl-5-methylpyrazol-3-yl)-1-(4-methoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 112822182) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-(2-benzyl-5-methylpyrazol-3-yl)-1-(4-methoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-(2-benzyl-5-methylpyrazol-3-yl)-1-(4-methoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 112822182 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-(2-benzyl-5-methylpyrazol-3-yl)-1-(4-methoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(-n2nnc(C(=O)Nc3cc(C)nn3Cc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C22H22N6O2/c1-15-13-20(27(25-15)14-17-7-5-4-6-8-17)23-22(29)21-16(2)28(26-24-21)18-9-11-19(30-3)12-10-18/h4-13H,14H2,1-3H3,(H,23,29) |
| InChIKey | RKDCEPKEDCQDJE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |