C20H22N4O2 — CID 17015548
N-benzyl-5-methyl-1-(4-propoxyphenyl)triazole-4-carboxamide (PubChem CID 17015548) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-benzyl-5-methyl-1-(4-propoxyphenyl)triazole-4-carboxamide.
| Compound Name | N-benzyl-5-methyl-1-(4-propoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 17015548 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-benzyl-5-methyl-1-(4-propoxyphenyl)triazole-4-carboxamide |
| SMILES | CCCOc1ccc(-n2nnc(C(=O)NCc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-3-13-26-18-11-9-17(10-12-18)24-15(2)19(22-23-24)20(25)21-14-16-7-5-4-6-8-16/h4-12H,3,13-14H2,1-2H3,(H,21,25) |
| InChIKey | LKVSMCBFXCTOLV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |