C38H43F3IrNO3- — CID 166496764
CID 166496764 (PubChem CID 166496764) has the molecular formula C38H43F3IrNO3- and a molecular weight of 810.98 g/mol.
| Compound Name | CID 166496764 |
|---|---|
| PubChem CID | 166496764 |
| Molecular Formula | C38H43F3IrNO3- |
| Molecular Weight | 810.98 g/mol |
| Exact Mass | 811.28 |
| IUPAC Name | — |
| SMILES | CCC(CC(F)(F)F)C(=O)/C=C(\O)C(CC)CC.Cc1ccc2[c-]c3c(c(C)c2c1)Oc1cc(CC(C)C)cc2ccnc-3c12.[Ir] |
| InChI | InChI=1S/C25H22NO.C13H21F3O2.Ir/c1-14(2)9-17-11-19-7-8-26-24-21-13-18-6-5-15(3)10-20(18)16(4)25(21)27-22(12-17)23(19)24;1-4-9(5-2)11(17)7-12(18)10(6-3)8-13(14,15)16;/h5-8,10-12,14H,9H2,1-4H3;7,9-10,17H,4-6,8H2,1-3H3;/q-1;;/b;11-7-; |
| InChIKey | LTVHGSZEPMFLMG-HUZFCYHXSA-N |
| XLogP | 11.19 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.98 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|