C7H11NO — CID 166497008
(2R,3R)-3-cyclopropyl-1-methylaziridine-2-carbaldehyde (PubChem CID 166497008) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (2R,3R)-3-cyclopropyl-1-methylaziridine-2-carbaldehyde.
| Compound Name | (2R,3R)-3-cyclopropyl-1-methylaziridine-2-carbaldehyde |
|---|---|
| PubChem CID | 166497008 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (2R,3R)-3-cyclopropyl-1-methylaziridine-2-carbaldehyde |
| SMILES | CN1[C@H](C2CC2)[C@@H]1C=O |
| InChI | InChI=1S/C7H11NO/c1-8-6(4-9)7(8)5-2-3-5/h4-7H,2-3H2,1H3/t6-,7+,8?/m0/s1 |
| InChIKey | BJXWINJEZRKANB-KJFJCRTCSA-N |
| XLogP | 0.28 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|