C8H11F2NO — CID 176875081
(2R,3R)-3-cyclopropyl-1-(2,2-difluoroethyl)aziridine-2-carbaldehyde (PubChem CID 176875081) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is (2R,3R)-3-cyclopropyl-1-(2,2-difluoroethyl)aziridine-2-carbaldehyde.
| Compound Name | (2R,3R)-3-cyclopropyl-1-(2,2-difluoroethyl)aziridine-2-carbaldehyde |
|---|---|
| PubChem CID | 176875081 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (2R,3R)-3-cyclopropyl-1-(2,2-difluoroethyl)aziridine-2-carbaldehyde |
| SMILES | O=C[C@H]1[C@@H](C2CC2)N1CC(F)F |
| InChI | InChI=1S/C8H11F2NO/c9-7(10)3-11-6(4-12)8(11)5-1-2-5/h4-8H,1-3H2/t6-,8+,11?/m0/s1 |
| InChIKey | KGSHIJQLZGRVFB-FXGWYQFXSA-N |
| XLogP | 0.91 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|