C18H22O3 — CID 166498628
[2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 2-methylbenzoate (PubChem CID 166498628) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 2-methylbenzoate.
| Compound Name | [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 166498628 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [2-oxo-2-[(1R)-1,2,2-trimethylcyclopent-3-en-1-yl]ethyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCC(=O)[C@]1(C)CC=CC1(C)C |
| InChI | InChI=1S/C18H22O3/c1-13-8-5-6-9-14(13)16(20)21-12-15(19)18(4)11-7-10-17(18,2)3/h5-10H,11-12H2,1-4H3/t18-/m0/s1 |
| InChIKey | WCCNPXQTRRECRB-SFHVURJKSA-N |
| XLogP | 3.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|