C51H32 — CID 166501670
7-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]naphthalen-2-yl]-11H-benzo[a]fluorene (PubChem CID 166501670) has the molecular formula C51H32 and a molecular weight of 659.91 g/mol. Its IUPAC name is 7-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]naphthalen-2-yl]-11H-benzo[a]fluorene.
| Compound Name | 7-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]naphthalen-2-yl]-11H-benzo[a]fluorene |
|---|---|
| PubChem CID | 166501670 |
| Molecular Formula | C51H32 |
| Molecular Weight | 659.91 g/mol |
| Exact Mass | 659.34 |
| IUPAC Name | 7-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]naphthalen-2-yl]-11H-benzo[a]fluorene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4cc5ccccc5cc4-c4cccc5c4-c4ccc6ccccc6c4C5)c4c([2H])c([2H])c([2H])c([2H])c34)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C51H32/c1-2-16-35-30-48(47(29-34(35)15-1)44-26-12-18-36-31-46-38-20-6-4-14-33(38)27-28-45(46)49(36)44)51-42-23-9-7-21-40(42)50(41-22-8-10-24-43(41)51)39-25-11-17-32-13-3-5-19-37(32)39/h1-30H,31H2/i3D,5D,7D,8D,9D,10D,11D,13D,17D,19D,21D,22D,23D,24D,25D |
| InChIKey | UGUDSMNGSPVMLI-MMYFUOPTSA-N |
| XLogP | 14.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.91 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|