C47H43BN2O — CID 166502066
N,N-bis(4-tert-butylphenyl)-11-methyl-8-phenyl-15-oxa-8-aza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.016,21]tricosa-2(7),3,5,9,11,13(23),14(22),16,18,20-decaen-4-amine (PubChem CID 166502066) has the molecular formula C47H43BN2O and a molecular weight of 662.69 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-11-methyl-8-phenyl-15-oxa-8-aza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.016,21]tricosa-2(7),3,5,9,11,13(23),14(22),16,18,20-decaen-4-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)-11-methyl-8-phenyl-15-oxa-8-aza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.016,21]tricosa-2(7),3,5,9,11,13(23),14(22),16,18,20-decaen-4-amine |
|---|---|
| PubChem CID | 166502066 |
| Molecular Formula | C47H43BN2O |
| Molecular Weight | 662.69 g/mol |
| Exact Mass | 662.35 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-11-methyl-8-phenyl-15-oxa-8-aza-1-borahexacyclo[11.9.1.02,7.09,23.014,22.016,21]tricosa-2(7),3,5,9,11,13(23),14(22),16,18,20-decaen-4-amine |
| SMILES | Cc1cc2c3c(c1)N(c1ccccc1)c1ccc(N(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)cc1B3c1c-2oc2ccccc12 |
| InChI | InChI=1S/C47H43BN2O/c1-30-27-38-43-41(28-30)50(33-13-9-8-10-14-33)40-26-25-36(29-39(40)48(43)44-37-15-11-12-16-42(37)51-45(38)44)49(34-21-17-31(18-22-34)46(2,3)4)35-23-19-32(20-24-35)47(5,6)7/h8-29H,1-7H3 |
| InChIKey | KSVASPISRCMLSG-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.69 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|