C16H9ClS — CID 166503443
11-chloronaphtho[2,1-b][1]benzothiole (PubChem CID 166503443) has the molecular formula C16H9ClS and a molecular weight of 268.77 g/mol. Its IUPAC name is 11-chloronaphtho[2,1-b][1]benzothiole.
| Compound Name | 11-chloronaphtho[2,1-b][1]benzothiole |
|---|---|
| PubChem CID | 166503443 |
| Molecular Formula | C16H9ClS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 11-chloronaphtho[2,1-b][1]benzothiole |
| SMILES | Clc1cccc2sc3ccc4ccccc4c3c12 |
| InChI | InChI=1S/C16H9ClS/c17-12-6-3-7-13-16(12)15-11-5-2-1-4-10(11)8-9-14(15)18-13/h1-9H |
| InChIKey | DRQUKEVBQNSPKY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |