C16H12N2S — CID 138493784
naphtho[2,1-b][1]benzothiole-8,9-diamine (PubChem CID 138493784) has the molecular formula C16H12N2S and a molecular weight of 264.35 g/mol. Its IUPAC name is naphtho[2,1-b][1]benzothiole-8,9-diamine.
| Compound Name | naphtho[2,1-b][1]benzothiole-8,9-diamine |
|---|---|
| PubChem CID | 138493784 |
| Molecular Formula | C16H12N2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | naphtho[2,1-b][1]benzothiole-8,9-diamine |
| SMILES | Nc1ccc2c(sc3ccc4ccccc4c32)c1N |
| InChI | InChI=1S/C16H12N2S/c17-12-7-6-11-14-10-4-2-1-3-9(10)5-8-13(14)19-16(11)15(12)18/h1-8H,17-18H2 |
| InChIKey | ZAPWALPLLNMTIU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|