C18H30N2O7P- — CID 166504446
tert-butyl [2-(2,2-dimethylpropyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phosphate (PubChem CID 166504446) has the molecular formula C18H30N2O7P- and a molecular weight of 417.42 g/mol. Its IUPAC name is tert-butyl [2-(2,2-dimethylpropyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phosphate.
| Compound Name | tert-butyl [2-(2,2-dimethylpropyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phosphate |
|---|---|
| PubChem CID | 166504446 |
| Molecular Formula | C18H30N2O7P- |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | tert-butyl [2-(2,2-dimethylpropyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] phosphate |
| SMILES | Cc1cn(C2CC(OP(=O)([O-])OC(C)(C)C)C(CC(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H31N2O7P/c1-11-10-20(16(22)19-15(11)21)14-8-12(13(25-14)9-17(2,3)4)26-28(23,24)27-18(5,6)7/h10,12-14H,8-9H2,1-7H3,(H,23,24)(H,19,21,22)/p-1 |
| InChIKey | IHFPBPOVOQMBIK-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|