C16H16ClN5O7P- — CID 135021225
[(2R,3S,5R)-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-chlorophenyl) phosphate (PubChem CID 135021225) has the molecular formula C16H16ClN5O7P- and a molecular weight of 456.76 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-chlorophenyl) phosphate.
| Compound Name | [(2R,3S,5R)-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-chlorophenyl) phosphate |
|---|---|
| PubChem CID | 135021225 |
| Molecular Formula | C16H16ClN5O7P- |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | [(2R,3S,5R)-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-chlorophenyl) phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](OP(=O)([O-])Oc3ccccc3Cl)[C@@H](CN=[N+]=[N-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17ClN5O7P/c1-9-8-22(16(24)20-15(9)23)14-6-12(13(27-14)7-19-21-18)29-30(25,26)28-11-5-3-2-4-10(11)17/h2-5,8,12-14H,6-7H2,1H3,(H,25,26)(H,20,23,24)/p-1/t12-,13+,14+/m0/s1 |
| InChIKey | YSUXZFLFAOQSCY-BFHYXJOUSA-M |
| XLogP | 2.03 |
| TPSA | 171.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|