C17H19BrF2N2O2S — CID 166504904
4-[5-bromo-2-(2,4-difluoroanilino)-1,3-thiazol-4-yl]-4-ethylhexanoic acid (PubChem CID 166504904) has the molecular formula C17H19BrF2N2O2S and a molecular weight of 433.32 g/mol. Its IUPAC name is 4-[5-bromo-2-(2,4-difluoroanilino)-1,3-thiazol-4-yl]-4-ethylhexanoic acid.
| Compound Name | 4-[5-bromo-2-(2,4-difluoroanilino)-1,3-thiazol-4-yl]-4-ethylhexanoic acid |
|---|---|
| PubChem CID | 166504904 |
| Molecular Formula | C17H19BrF2N2O2S |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 4-[5-bromo-2-(2,4-difluoroanilino)-1,3-thiazol-4-yl]-4-ethylhexanoic acid |
| SMILES | CCC(CC)(CCC(=O)O)c1nc(Nc2ccc(F)cc2F)sc1Br |
| InChI | InChI=1S/C17H19BrF2N2O2S/c1-3-17(4-2,8-7-13(23)24)14-15(18)25-16(22-14)21-12-6-5-10(19)9-11(12)20/h5-6,9H,3-4,7-8H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | GOAFWCMTXSQHDC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |