C12H13BrN2O2 — CID 166505833
2-bromo-N-ethyl-N-(2-methyl-1,3-benzoxazol-6-yl)acetamide (PubChem CID 166505833) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is 2-bromo-N-ethyl-N-(2-methyl-1,3-benzoxazol-6-yl)acetamide.
| Compound Name | 2-bromo-N-ethyl-N-(2-methyl-1,3-benzoxazol-6-yl)acetamide |
|---|---|
| PubChem CID | 166505833 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-bromo-N-ethyl-N-(2-methyl-1,3-benzoxazol-6-yl)acetamide |
| SMILES | CCN(C(=O)CBr)c1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C12H13BrN2O2/c1-3-15(12(16)7-13)9-4-5-10-11(6-9)17-8(2)14-10/h4-6H,3,7H2,1-2H3 |
| InChIKey | PLJMMDAVHLHWOK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|