C16H20O6S — CID 166506043
benzyl 3-(1,2-diformyloxyethylsulfanyl)-2,2-dimethylpropanoate (PubChem CID 166506043) has the molecular formula C16H20O6S and a molecular weight of 340.40 g/mol. Its IUPAC name is benzyl 3-(1,2-diformyloxyethylsulfanyl)-2,2-dimethylpropanoate.
| Compound Name | benzyl 3-(1,2-diformyloxyethylsulfanyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166506043 |
| Molecular Formula | C16H20O6S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | benzyl 3-(1,2-diformyloxyethylsulfanyl)-2,2-dimethylpropanoate |
| SMILES | CC(C)(CSC(COC=O)OC=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H20O6S/c1-16(2,10-23-14(22-12-18)9-20-11-17)15(19)21-8-13-6-4-3-5-7-13/h3-7,11-12,14H,8-10H2,1-2H3 |
| InChIKey | DFZFQWKFWLNCQI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|