C22H30N2O — CID 166506565
3-[[(3S)-3-(ethoxymethyl)-3-[2-(4-methylphenyl)ethyl]pyrrolidin-1-yl]methyl]pyridine (PubChem CID 166506565) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 3-[[(3S)-3-(ethoxymethyl)-3-[2-(4-methylphenyl)ethyl]pyrrolidin-1-yl]methyl]pyridine.
| Compound Name | 3-[[(3S)-3-(ethoxymethyl)-3-[2-(4-methylphenyl)ethyl]pyrrolidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 166506565 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 3-[[(3S)-3-(ethoxymethyl)-3-[2-(4-methylphenyl)ethyl]pyrrolidin-1-yl]methyl]pyridine |
| SMILES | CCOC[C@@]1(CCc2ccc(C)cc2)CCN(Cc2cccnc2)C1 |
| InChI | InChI=1S/C22H30N2O/c1-3-25-18-22(11-10-20-8-6-19(2)7-9-20)12-14-24(17-22)16-21-5-4-13-23-15-21/h4-9,13,15H,3,10-12,14,16-18H2,1-2H3/t22-/m0/s1 |
| InChIKey | VWQLUGCBKKXAAL-QFIPXVFZSA-N |
| XLogP | 4.25 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |