C21H27ClN2O — CID 135322793
3-[[3-[2-(4-chlorophenyl)ethyl]-3-(ethoxymethyl)pyrrolidin-1-yl]methyl]pyridine (PubChem CID 135322793) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 3-[[3-[2-(4-chlorophenyl)ethyl]-3-(ethoxymethyl)pyrrolidin-1-yl]methyl]pyridine.
| Compound Name | 3-[[3-[2-(4-chlorophenyl)ethyl]-3-(ethoxymethyl)pyrrolidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 135322793 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[[3-[2-(4-chlorophenyl)ethyl]-3-(ethoxymethyl)pyrrolidin-1-yl]methyl]pyridine |
| SMILES | CCOCC1(CCc2ccc(Cl)cc2)CCN(Cc2cccnc2)C1 |
| InChI | InChI=1S/C21H27ClN2O/c1-2-25-17-21(10-9-18-5-7-20(22)8-6-18)11-13-24(16-21)15-19-4-3-12-23-14-19/h3-8,12,14H,2,9-11,13,15-17H2,1H3 |
| InChIKey | FGGPWFSTSXZUDG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |