C23H32N8O — CID 166507526
N-(2,8-dimethylimidazo[1,2-a]pyrazin-6-yl)-5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrazine-2-carboxamide (PubChem CID 166507526) has the molecular formula C23H32N8O and a molecular weight of 436.56 g/mol. Its IUPAC name is N-(2,8-dimethylimidazo[1,2-a]pyrazin-6-yl)-5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrazine-2-carboxamide.
| Compound Name | N-(2,8-dimethylimidazo[1,2-a]pyrazin-6-yl)-5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166507526 |
| Molecular Formula | C23H32N8O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | N-(2,8-dimethylimidazo[1,2-a]pyrazin-6-yl)-5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrazine-2-carboxamide |
| SMILES | Cc1cn2cc(NC(=O)c3cnc(N(C)C4CC(C)(C)NC(C)(C)C4)cn3)nc(C)c2n1 |
| InChI | InChI=1S/C23H32N8O/c1-14-12-31-13-18(27-15(2)20(31)26-14)28-21(32)17-10-25-19(11-24-17)30(7)16-8-22(3,4)29-23(5,6)9-16/h10-13,16,29H,8-9H2,1-7H3,(H,28,32) |
| InChIKey | KDKWFYMDRHPKKN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |