C24H31N7S — CID 160920826
6-(2,8-dimethylimidazo[1,2-a]pyridin-6-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-b]pyrazin-2-amine (PubChem CID 160920826) has the molecular formula C24H31N7S and a molecular weight of 449.63 g/mol. Its IUPAC name is 6-(2,8-dimethylimidazo[1,2-a]pyridin-6-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-b]pyrazin-2-amine.
| Compound Name | 6-(2,8-dimethylimidazo[1,2-a]pyridin-6-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-b]pyrazin-2-amine |
|---|---|
| PubChem CID | 160920826 |
| Molecular Formula | C24H31N7S |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 6-(2,8-dimethylimidazo[1,2-a]pyridin-6-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-b]pyrazin-2-amine |
| SMILES | Cc1cn2cc(-c3cnc4nc(N(C)C5CC(C)(C)NC(C)(C)C5)sc4n3)cc(C)c2n1 |
| InChI | InChI=1S/C24H31N7S/c1-14-8-16(13-31-12-15(2)26-20(14)31)18-11-25-19-21(27-18)32-22(28-19)30(7)17-9-23(3,4)29-24(5,6)10-17/h8,11-13,17,29H,9-10H2,1-7H3 |
| InChIKey | VULAOISSPFFIGJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |