C24H31N7S — CID 150928931
3-(2,7-dimethylindazol-5-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridazin-6-amine (PubChem CID 150928931) has the molecular formula C24H31N7S and a molecular weight of 449.63 g/mol. Its IUPAC name is 3-(2,7-dimethylindazol-5-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridazin-6-amine.
| Compound Name | 3-(2,7-dimethylindazol-5-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridazin-6-amine |
|---|---|
| PubChem CID | 150928931 |
| Molecular Formula | C24H31N7S |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 3-(2,7-dimethylindazol-5-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridazin-6-amine |
| SMILES | Cc1cc(-c2cc3sc(N(C)C4CC(C)(C)NC(C)(C)C4)nc3nn2)cc2cn(C)nc12 |
| InChI | InChI=1S/C24H31N7S/c1-14-8-15(9-16-13-30(6)28-20(14)16)18-10-19-21(27-26-18)25-22(32-19)31(7)17-11-23(2,3)29-24(4,5)12-17/h8-10,13,17,29H,11-12H2,1-7H3 |
| InChIKey | LFPLKBGPBDWABA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |