C29H42N4S — CID 153383264
6-(2,7-dimethylindazol-5-yl)-2-methyl-1,3-benzothiazole;ethane;2,2,4,6,6-pentamethylpiperidine (PubChem CID 153383264) has the molecular formula C29H42N4S and a molecular weight of 478.75 g/mol. Its IUPAC name is 6-(2,7-dimethylindazol-5-yl)-2-methyl-1,3-benzothiazole;ethane;2,2,4,6,6-pentamethylpiperidine.
| Compound Name | 6-(2,7-dimethylindazol-5-yl)-2-methyl-1,3-benzothiazole;ethane;2,2,4,6,6-pentamethylpiperidine |
|---|---|
| PubChem CID | 153383264 |
| Molecular Formula | C29H42N4S |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 6-(2,7-dimethylindazol-5-yl)-2-methyl-1,3-benzothiazole;ethane;2,2,4,6,6-pentamethylpiperidine |
| SMILES | CC.CC1CC(C)(C)NC(C)(C)C1.Cc1nc2ccc(-c3cc(C)c4nn(C)cc4c3)cc2s1 |
| InChI | InChI=1S/C17H15N3S.C10H21N.C2H6/c1-10-6-13(7-14-9-20(3)19-17(10)14)12-4-5-15-16(8-12)21-11(2)18-15;1-8-6-9(2,3)11-10(4,5)7-8;1-2/h4-9H,1-3H3;8,11H,6-7H2,1-5H3;1-2H3 |
| InChIKey | UCNRGFVZZMGNCR-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |