C22H26N6OS — CID 156888704
7-(2-methylindazol-5-yl)-2-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 156888704) has the molecular formula C22H26N6OS and a molecular weight of 422.56 g/mol. Its IUPAC name is 7-(2-methylindazol-5-yl)-2-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-(2-methylindazol-5-yl)-2-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 156888704 |
| Molecular Formula | C22H26N6OS |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 7-(2-methylindazol-5-yl)-2-(2,2,6,6-tetramethylpiperidin-4-yl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cn1cc2cc(-c3cc(=O)n4nc(C5CC(C)(C)NC(C)(C)C5)sc4n3)ccc2n1 |
| InChI | InChI=1S/C22H26N6OS/c1-21(2)10-15(11-22(3,4)26-21)19-25-28-18(29)9-17(23-20(28)30-19)13-6-7-16-14(8-13)12-27(5)24-16/h6-9,12,15,26H,10-11H2,1-5H3 |
| InChIKey | BUYFKEKFRNOGFE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |