C17H14N4O — CID 175920486
9-methyl-2-(2-methylindazol-5-yl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 175920486) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is 9-methyl-2-(2-methylindazol-5-yl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 9-methyl-2-(2-methylindazol-5-yl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 175920486 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 9-methyl-2-(2-methylindazol-5-yl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)cc(-c3ccc4nn(C)cc4c3)nc12 |
| InChI | InChI=1S/C17H14N4O/c1-11-4-3-7-21-16(22)9-15(18-17(11)21)12-5-6-14-13(8-12)10-20(2)19-14/h3-10H,1-2H3 |
| InChIKey | WLTFTOAZIHUJIO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |