C11H13N3O — CID 115022990
2-(2-aminoethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 115022990) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-(2-aminoethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(2-aminoethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115022990 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-(2-aminoethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)cc(CCN)nc12 |
| InChI | InChI=1S/C11H13N3O/c1-8-3-2-6-14-10(15)7-9(4-5-12)13-11(8)14/h2-3,6-7H,4-5,12H2,1H3 |
| InChIKey | GRPFEVHWQAUGOS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |