C19H19N5O4 — CID 46583586
1-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 46583586) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 46583586 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 1-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(Cc2cc(=O)n3cccc(C)c3n2)c1=O |
| InChI | InChI=1S/C19H19N5O4/c1-4-8-22-17(26)23(9-5-2)19(28)24(18(22)27)12-14-11-15(25)21-10-6-7-13(3)16(21)20-14/h4-7,10-11H,1-2,8-9,12H2,3H3 |
| InChIKey | GCQDFNSIAUNISN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|