C22H23N5O — CID 156888169
6-(2,7-dimethylindazol-5-yl)-3-piperidin-4-ylquinazolin-4-one (PubChem CID 156888169) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 6-(2,7-dimethylindazol-5-yl)-3-piperidin-4-ylquinazolin-4-one.
| Compound Name | 6-(2,7-dimethylindazol-5-yl)-3-piperidin-4-ylquinazolin-4-one |
|---|---|
| PubChem CID | 156888169 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 6-(2,7-dimethylindazol-5-yl)-3-piperidin-4-ylquinazolin-4-one |
| SMILES | Cc1cc(-c2ccc3ncn(C4CCNCC4)c(=O)c3c2)cc2cn(C)nc12 |
| InChI | InChI=1S/C22H23N5O/c1-14-9-16(10-17-12-26(2)25-21(14)17)15-3-4-20-19(11-15)22(28)27(13-24-20)18-5-7-23-8-6-18/h3-4,9-13,18,23H,5-8H2,1-2H3 |
| InChIKey | VUPUUPULHYLZOD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |